C34H41NO8 — CID 67566880
3-hydroxy-3-[(1R,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5-tris(phenylmethoxy)cyclopentyl]propanoic acid (PubChem CID 67566880) has the molecular formula C34H41NO8 and a molecular weight of 591.70 g/mol. Its IUPAC name is 3-hydroxy-3-[(1R,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5-tris(phenylmethoxy)cyclopentyl]propanoic acid.
| Compound Name | 3-hydroxy-3-[(1R,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5-tris(phenylmethoxy)cyclopentyl]propanoic acid |
|---|---|
| PubChem CID | 67566880 |
| Molecular Formula | C34H41NO8 |
| Molecular Weight | 591.70 g/mol |
| Exact Mass | 591.28 |
| IUPAC Name | 3-hydroxy-3-[(1R,2S,3R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3,4,5-tris(phenylmethoxy)cyclopentyl]propanoic acid |
| SMILES | CC(C)(C)OC(=O)N[C@H]1[C@H](C(O)CC(=O)O)C(OCc2ccccc2)C(OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C34H41NO8/c1-34(2,3)43-33(39)35-29-28(26(36)19-27(37)38)30(40-20-23-13-7-4-8-14-23)32(42-22-25-17-11-6-12-18-25)31(29)41-21-24-15-9-5-10-16-24/h4-18,26,28-32,36H,19-22H2,1-3H3,(H,35,39)(H,37,38)/t26?,28-,29-,30?,31+,32?/m0/s1 |
| InChIKey | FVXJDXIJRYEPNI-BMKPXUTRSA-N |
| XLogP | 5.10 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |