About [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate
[2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate (PubChem CID 158695966) has the molecular formula C24H28O3
and a molecular weight of 364.48 g/mol. Its IUPAC name is [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate.
Molecular Properties
| Compound Name | [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate |
| PubChem CID | 158695966 |
| Molecular Formula | C24H28O3 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.20 |
| IUPAC Name | [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate |
| SMILES | O=C(COC(=O)CC1CC1)Cc1ccc(CCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C24H28O3/c25-23(18-27-24(26)17-22-14-15-22)16-21-12-10-20(11-13-21)9-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,10-13,22H,4-5,8-9,14-18H2 |
| InChIKey | ZUBCPFIMWYUPJL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate?
The IUPAC name of [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate (CID 158695966) is [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate.
What is the SMILES notation for [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate?
The canonical SMILES for [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate is O=C(COC(=O)CC1CC1)Cc1ccc(CCCCc2ccccc2)cc1.
What is the InChIKey of [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate?
The InChIKey is ZUBCPFIMWYUPJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28O3/c25-23(18-27-24(26)17-22-14-15-22)16-21-12-10-20(11-13-21)9-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,10-13,22H,4-5,8-9,14-18H2.
What are the key properties of [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate?
[2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate has a molecular weight of 364.48 g/mol, XLogP of 4.71, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-3-[4-(4-phenylbutyl)phenyl]propyl] 2-cyclopropylacetate is sourced from PubChem (CID 158695966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).