C36H43F2O2S+ — CID 158707545
5,5-difluoroheptyl adamantane-1-carboxylate;triphenylsulfanium (PubChem CID 158707545) has the molecular formula C36H43F2O2S+ and a molecular weight of 577.80 g/mol. Its IUPAC name is 5,5-difluoroheptyl adamantane-1-carboxylate;triphenylsulfanium.
| Compound Name | 5,5-difluoroheptyl adamantane-1-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 158707545 |
| Molecular Formula | C36H43F2O2S+ |
| Molecular Weight | 577.80 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 5,5-difluoroheptyl adamantane-1-carboxylate;triphenylsulfanium |
| SMILES | CCC(F)(F)CCCCOC(=O)C12CC3CC(CC(C3)C1)C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H28F2O2.C18H15S/c1-2-18(19,20)5-3-4-6-22-16(21)17-10-13-7-14(11-17)9-15(8-13)12-17;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h13-15H,2-12H2,1H3;1-15H/q;+1 |
| InChIKey | IIHOYEIZSDYXCB-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.80 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|