C11H10BrNO2 — CID 158710604
2-bromo-3,6-dimethyl-1H-indole;carbon dioxide (PubChem CID 158710604) has the molecular formula C11H10BrNO2 and a molecular weight of 268.11 g/mol. Its IUPAC name is 2-bromo-3,6-dimethyl-1H-indole;carbon dioxide.
| Compound Name | 2-bromo-3,6-dimethyl-1H-indole;carbon dioxide |
|---|---|
| PubChem CID | 158710604 |
| Molecular Formula | C11H10BrNO2 |
| Molecular Weight | 268.11 g/mol |
| Exact Mass | 266.99 |
| IUPAC Name | 2-bromo-3,6-dimethyl-1H-indole;carbon dioxide |
| SMILES | Cc1ccc2c(C)c(Br)[nH]c2c1.O=C=O |
| InChI | InChI=1S/C10H10BrN.CO2/c1-6-3-4-8-7(2)10(11)12-9(8)5-6;2-1-3/h3-5,12H,1-2H3; |
| InChIKey | IIQZIVIILBGEQM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.11 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |