C16H36N2O4 — CID 158710641
4,4-diamino-5,5-bis(2-hydroxypropyl)-6-methylnonane-2,8-diol (PubChem CID 158710641) has the molecular formula C16H36N2O4 and a molecular weight of 320.47 g/mol. Its IUPAC name is 4,4-diamino-5,5-bis(2-hydroxypropyl)-6-methylnonane-2,8-diol.
| Compound Name | 4,4-diamino-5,5-bis(2-hydroxypropyl)-6-methylnonane-2,8-diol |
|---|---|
| PubChem CID | 158710641 |
| Molecular Formula | C16H36N2O4 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 4,4-diamino-5,5-bis(2-hydroxypropyl)-6-methylnonane-2,8-diol |
| SMILES | CC(O)CC(C)C(CC(C)O)(CC(C)O)C(N)(N)CC(C)O |
| InChI | InChI=1S/C16H36N2O4/c1-10(6-11(2)19)15(7-12(3)20,8-13(4)21)16(17,18)9-14(5)22/h10-14,19-22H,6-9,17-18H2,1-5H3 |
| InChIKey | IIRBTKVJVMIDQC-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|