C26H45O16+ — CID 158710799
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;(5-methoxy-2,5-dioxopentanoyl)-methylideneoxidanium;2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,5-dioxohexanoate (PubChem CID 158710799) has the molecular formula C26H45O16+ and a molecular weight of 613.63 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;(5-methoxy-2,5-dioxopentanoyl)-methylideneoxidanium;2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,5-dioxohexanoate.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;(5-methoxy-2,5-dioxopentanoyl)-methylideneoxidanium;2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,5-dioxohexanoate |
|---|---|
| PubChem CID | 158710799 |
| Molecular Formula | C26H45O16+ |
| Molecular Weight | 613.63 g/mol |
| Exact Mass | 613.27 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;(5-methoxy-2,5-dioxopentanoyl)-methylideneoxidanium;2-[2-(2-methoxyethoxy)ethoxy]ethyl 2,5-dioxohexanoate |
| SMILES | C=[O+]C(=O)C(=O)CCC(=O)OC.COCCOCCOCCOC(=O)C(=O)CCC(C)=O.OCCOCCOCCO |
| InChI | InChI=1S/C13H22O7.C7H9O5.C6H14O4/c1-11(14)3-4-12(15)13(16)20-10-9-19-8-7-18-6-5-17-2;1-11-6(9)4-3-5(8)7(10)12-2;7-1-3-9-5-6-10-4-2-8/h3-10H2,1-2H3;2-4H2,1H3;7-8H,1-6H2/q;+1; |
| InChIKey | IIROQNKIPVHIIZ-UHFFFAOYSA-N |
| XLogP | -1.45 |
| TPSA | 218.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.63 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|