C28H20N4 — CID 158716869
3-[[3,5-bis(4-ethenylphenyl)phenyl]methyl]-5-isocyanoimidazole-4-carbonitrile (PubChem CID 158716869) has the molecular formula C28H20N4 and a molecular weight of 412.50 g/mol. Its IUPAC name is 3-[[3,5-bis(4-ethenylphenyl)phenyl]methyl]-5-isocyanoimidazole-4-carbonitrile.
| Compound Name | 3-[[3,5-bis(4-ethenylphenyl)phenyl]methyl]-5-isocyanoimidazole-4-carbonitrile |
|---|---|
| PubChem CID | 158716869 |
| Molecular Formula | C28H20N4 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-[[3,5-bis(4-ethenylphenyl)phenyl]methyl]-5-isocyanoimidazole-4-carbonitrile |
| SMILES | [C-]#[N+]c1ncn(Cc2cc(-c3ccc(C=C)cc3)cc(-c3ccc(C=C)cc3)c2)c1C#N |
| InChI | InChI=1S/C28H20N4/c1-4-20-6-10-23(11-7-20)25-14-22(18-32-19-31-28(30-3)27(32)17-29)15-26(16-25)24-12-8-21(5-2)9-13-24/h4-16,19H,1-2,18H2 |
| InChIKey | FQSDIOQEHZDSJQ-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 45.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|