C34H32Cl2N10O10 — CID 158719603
[(2R)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate;[(2R)-4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate;6-chloro-7H-purin-2-amine (PubChem CID 158719603) has the molecular formula C34H32Cl2N10O10 and a molecular weight of 811.60 g/mol. Its IUPAC name is [(2R)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate;[(2R)-4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate;6-chloro-7H-purin-2-amine.
| Compound Name | [(2R)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate;[(2R)-4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate;6-chloro-7H-purin-2-amine |
|---|---|
| PubChem CID | 158719603 |
| Molecular Formula | C34H32Cl2N10O10 |
| Molecular Weight | 811.60 g/mol |
| Exact Mass | 810.17 |
| IUPAC Name | [(2R)-4-acetyloxy-1,3-dioxolan-2-yl]methyl benzoate;[(2R)-4-(2-amino-6-chloropurin-9-yl)-1,3-dioxolan-2-yl]methyl benzoate;6-chloro-7H-purin-2-amine |
| SMILES | CC(=O)OC1CO[C@@H](COC(=O)c2ccccc2)O1.Nc1nc(Cl)c2[nH]cnc2n1.Nc1nc(Cl)c2ncn(C3CO[C@@H](COC(=O)c4ccccc4)O3)c2n1 |
| InChI | InChI=1S/C16H14ClN5O4.C13H14O6.C5H4ClN5/c17-13-12-14(21-16(18)20-13)22(8-19-12)10-6-24-11(26-10)7-25-15(23)9-4-2-1-3-5-9;1-9(14)18-12-8-16-11(19-12)7-17-13(15)10-5-3-2-4-6-10;6-3-2-4(9-1-8-2)11-5(7)10-3/h1-5,8,10-11H,6-7H2,(H2,18,20,21);2-6,11-12H,7-8H2,1H3;1H,(H3,7,8,9,10,11)/t10?,11-;11-,12?;/m11./s1 |
| InChIKey | IJTAKEHROKIFPY-JPOXERRGSA-N |
| XLogP | 3.48 |
| TPSA | 265.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.60 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|