C13H20O3 — CID 158723322
3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-prop-2-enoxyoxirane (PubChem CID 158723322) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-prop-2-enoxyoxirane.
| Compound Name | 3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-prop-2-enoxyoxirane |
|---|---|
| PubChem CID | 158723322 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-prop-2-enoxyoxirane |
| SMILES | C=CC1CCC2OC2C1.C=CCOC1CO1 |
| InChI | InChI=1S/C8H12O.C5H8O2/c1-2-6-3-4-7-8(5-6)9-7;1-2-3-6-5-4-7-5/h2,6-8H,1,3-5H2;2,5H,1,3-4H2 |
| InChIKey | IKEMCLMDXXMSBW-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|