C24H38O5 — CID 90918808
3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-ethenyl-4-(7-oxabicyclo[4.1.0]heptan-3-ylmethylperoxymethyl)cyclohexan-1-ol (PubChem CID 90918808) has the molecular formula C24H38O5 and a molecular weight of 406.56 g/mol. Its IUPAC name is 3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-ethenyl-4-(7-oxabicyclo[4.1.0]heptan-3-ylmethylperoxymethyl)cyclohexan-1-ol.
| Compound Name | 3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-ethenyl-4-(7-oxabicyclo[4.1.0]heptan-3-ylmethylperoxymethyl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 90918808 |
| Molecular Formula | C24H38O5 |
| Molecular Weight | 406.56 g/mol |
| Exact Mass | 406.27 |
| IUPAC Name | 3-ethenyl-7-oxabicyclo[4.1.0]heptane;2-ethenyl-4-(7-oxabicyclo[4.1.0]heptan-3-ylmethylperoxymethyl)cyclohexan-1-ol |
| SMILES | C=CC1CC(COOCC2CCC3OC3C2)CCC1O.C=CC1CCC2OC2C1 |
| InChI | InChI=1S/C16H26O4.C8H12O/c1-2-13-7-11(3-5-14(13)17)9-18-19-10-12-4-6-15-16(8-12)20-15;1-2-6-3-4-7-8(5-6)9-7/h2,11-17H,1,3-10H2;2,6-8H,1,3-5H2 |
| InChIKey | WGEIYXDKHDCANP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 63.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.56 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|