C17H26O4 — CID 59097460
10-ethenyl-3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2,4-dioxaspiro[5.5]undecan-9-ol (PubChem CID 59097460) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is 10-ethenyl-3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2,4-dioxaspiro[5.5]undecan-9-ol.
| Compound Name | 10-ethenyl-3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2,4-dioxaspiro[5.5]undecan-9-ol |
|---|---|
| PubChem CID | 59097460 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | 10-ethenyl-3-(7-oxabicyclo[4.1.0]heptan-3-yl)-2,4-dioxaspiro[5.5]undecan-9-ol |
| SMILES | C=CC1CC2(CCC1O)COC(C1CCC3OC3C1)OC2 |
| InChI | InChI=1S/C17H26O4/c1-2-11-8-17(6-5-13(11)18)9-19-16(20-10-17)12-3-4-14-15(7-12)21-14/h2,11-16,18H,1,3-10H2 |
| InChIKey | IIYJRQIPCFHINT-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|