C9H16O3 — CID 125494016
(2R,5S)-2-methoxy-5-prop-2-enoxyoxane (PubChem CID 125494016) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2R,5S)-2-methoxy-5-prop-2-enoxyoxane.
| Compound Name | (2R,5S)-2-methoxy-5-prop-2-enoxyoxane |
|---|---|
| PubChem CID | 125494016 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2R,5S)-2-methoxy-5-prop-2-enoxyoxane |
| SMILES | C=CCO[C@H]1CC[C@H](OC)OC1 |
| InChI | InChI=1S/C9H16O3/c1-3-6-11-8-4-5-9(10-2)12-7-8/h3,8-9H,1,4-7H2,2H3/t8-,9+/m0/s1 |
| InChIKey | XSMDCKSRCYUMEQ-DTWKUNHWSA-N |
| XLogP | 1.34 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|