C26H39N3O5S2 — CID 158756950
(1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20-triazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone (PubChem CID 158756950) has the molecular formula C26H39N3O5S2 and a molecular weight of 537.75 g/mol. Its IUPAC name is (1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20-triazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone.
| Compound Name | (1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20-triazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone |
|---|---|
| PubChem CID | 158756950 |
| Molecular Formula | C26H39N3O5S2 |
| Molecular Weight | 537.75 g/mol |
| Exact Mass | 537.23 |
| IUPAC Name | (1S,7E,16Z,21S)-7-ethylidene-6-methylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,8,20-triazabicyclo[8.7.6]tricos-16-ene-3,9,19,22-tetrone |
| SMILES | C=C1NC(C(C)C)C(=O)O[C@@H]2/C=C\CCSSCC(CC(=O)[C@H](C(C)C)NC(=O)C2)C(=O)N/C1=C/C |
| InChI | InChI=1S/C26H39N3O5S2/c1-7-20-17(6)27-24(16(4)5)26(33)34-19-10-8-9-11-35-36-14-18(25(32)28-20)12-21(30)23(15(2)3)29-22(31)13-19/h7-8,10,15-16,18-19,23-24,27H,6,9,11-14H2,1-5H3,(H,28,32)(H,29,31)/b10-8-,20-7+/t18?,19-,23+,24?/m1/s1 |
| InChIKey | CWPFVXKRPRXDCJ-RDDNDDOGSA-N |
| XLogP | 3.51 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.75 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|