C25H37N3O6S2 — CID 58329956
(7E,16E)-7-ethylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,20,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone (PubChem CID 58329956) has the molecular formula C25H37N3O6S2 and a molecular weight of 539.72 g/mol. Its IUPAC name is (7E,16E)-7-ethylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,20,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone.
| Compound Name | (7E,16E)-7-ethylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,20,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
|---|---|
| PubChem CID | 58329956 |
| Molecular Formula | C25H37N3O6S2 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.21 |
| IUPAC Name | (7E,16E)-7-ethylidene-4,21-di(propan-2-yl)-2-oxa-12,13-dithia-5,20,23-triazabicyclo[8.7.6]tricos-16-ene-3,6,9,19,22-pentone |
| SMILES | C/C=C1\CC(=O)C2CSSCC/C=C/C(CC(=O)NC(C(C)C)C(=O)N2)OC(=O)C(C(C)C)NC1=O |
| InChI | InChI=1S/C25H37N3O6S2/c1-6-16-11-19(29)18-13-36-35-10-8-7-9-17(34-25(33)22(15(4)5)28-23(16)31)12-20(30)27-21(14(2)3)24(32)26-18/h6-7,9,14-15,17-18,21-22H,8,10-13H2,1-5H3,(H,26,32)(H,27,30)(H,28,31)/b9-7+,16-6+ |
| InChIKey | VXNRCWHJZCUMSI-VVSPOSHSSA-N |
| XLogP | 2.32 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|