C22H28O2 — CID 158772141
2-(3,5-ditert-butylphenyl)-2-(2-hydroxyphenyl)acetaldehyde (PubChem CID 158772141) has the molecular formula C22H28O2 and a molecular weight of 324.46 g/mol. Its IUPAC name is 2-(3,5-ditert-butylphenyl)-2-(2-hydroxyphenyl)acetaldehyde.
| Compound Name | 2-(3,5-ditert-butylphenyl)-2-(2-hydroxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 158772141 |
| Molecular Formula | C22H28O2 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.21 |
| IUPAC Name | 2-(3,5-ditert-butylphenyl)-2-(2-hydroxyphenyl)acetaldehyde |
| SMILES | CC(C)(C)c1cc(C(C=O)c2ccccc2O)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H28O2/c1-21(2,3)16-11-15(12-17(13-16)22(4,5)6)19(14-23)18-9-7-8-10-20(18)24/h7-14,19,24H,1-6H3 |
| InChIKey | YQWBCAOJCKPAIE-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|