C20H28O3S — CID 158772615
2-[4-(benzenesulfonyl)butoxy]adamantane (PubChem CID 158772615) has the molecular formula C20H28O3S and a molecular weight of 348.51 g/mol. Its IUPAC name is 2-[4-(benzenesulfonyl)butoxy]adamantane.
| Compound Name | 2-[4-(benzenesulfonyl)butoxy]adamantane |
|---|---|
| PubChem CID | 158772615 |
| Molecular Formula | C20H28O3S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | 2-[4-(benzenesulfonyl)butoxy]adamantane |
| SMILES | O=S(=O)(CCCCOC1C2CC3CC(C2)CC1C3)c1ccccc1 |
| InChI | InChI=1S/C20H28O3S/c21-24(22,19-6-2-1-3-7-19)9-5-4-8-23-20-17-11-15-10-16(13-17)14-18(20)12-15/h1-3,6-7,15-18,20H,4-5,8-14H2 |
| InChIKey | OXRNJFSDDOJIKQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|