C17H11ClN2O2 — CID 158774254
5-chloro-3-(3-nitroso-1H-inden-2-yl)-1H-indol-2-ol (PubChem CID 158774254) has the molecular formula C17H11ClN2O2 and a molecular weight of 310.74 g/mol. Its IUPAC name is 5-chloro-3-(3-nitroso-1H-inden-2-yl)-1H-indol-2-ol.
| Compound Name | 5-chloro-3-(3-nitroso-1H-inden-2-yl)-1H-indol-2-ol |
|---|---|
| PubChem CID | 158774254 |
| Molecular Formula | C17H11ClN2O2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 5-chloro-3-(3-nitroso-1H-inden-2-yl)-1H-indol-2-ol |
| SMILES | O=NC1=C(c2c(O)[nH]c3ccc(Cl)cc23)Cc2ccccc21 |
| InChI | InChI=1S/C17H11ClN2O2/c18-10-5-6-14-12(8-10)15(17(21)19-14)13-7-9-3-1-2-4-11(9)16(13)20-22/h1-6,8,19,21H,7H2 |
| InChIKey | PZGHMNAKFSFIIH-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 65.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |