C27H47F3N4O7S — CID 158774348
(2S)-6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 158774348) has the molecular formula C27H47F3N4O7S and a molecular weight of 628.76 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 158774348 |
| Molecular Formula | C27H47F3N4O7S |
| Molecular Weight | 628.76 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2R,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]sulfamoylamino]hexanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@H](NC(=O)[C@H](CC1CCCCC1)NS(=O)(=O)N[C@@H](CCCCN)C(=O)O)C2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C25H46N4O5S.C2HF3O2/c1-24(2)18-12-13-25(24,3)21(16-18)27-22(30)20(15-17-9-5-4-6-10-17)29-35(33,34)28-19(23(31)32)11-7-8-14-26;3-2(4,5)1(6)7/h17-21,28-29H,4-16,26H2,1-3H3,(H,27,30)(H,31,32);(H,6,7)/t18-,19+,20+,21-,25+;/m1./s1 |
| InChIKey | QVLHGWRHXGFXLR-PFGYAUINSA-N |
| XLogP | 3.30 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.76 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|