C27H49N5O5S — CID 68549003
(2S)-6-(1-aminoethylideneamino)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]-sulfamoylamino]hexanoic acid (PubChem CID 68549003) has the molecular formula C27H49N5O5S and a molecular weight of 555.79 g/mol. Its IUPAC name is (2S)-6-(1-aminoethylideneamino)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]-sulfamoylamino]hexanoic acid.
| Compound Name | (2S)-6-(1-aminoethylideneamino)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]-sulfamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 68549003 |
| Molecular Formula | C27H49N5O5S |
| Molecular Weight | 555.79 g/mol |
| Exact Mass | 555.35 |
| IUPAC Name | (2S)-6-(1-aminoethylideneamino)-2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(1R,2S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]amino]propan-2-yl]-sulfamoylamino]hexanoic acid |
| SMILES | C/C(N)=N\CCCC[C@@H](C(=O)O)N([C@@H](CC1CCCCC1)C(=O)N[C@H]1C[C@H]2CC[C@]1(C)C2(C)C)S(N)(=O)=O |
| InChI | InChI=1S/C27H49N5O5S/c1-18(28)30-15-9-8-12-21(25(34)35)32(38(29,36)37)22(16-19-10-6-5-7-11-19)24(33)31-23-17-20-13-14-27(23,4)26(20,2)3/h19-23H,5-17H2,1-4H3,(H2,28,30)(H,31,33)(H,34,35)(H2,29,36,37)/t20-,21+,22+,23+,27+/m1/s1 |
| InChIKey | WYWMYMGBKFAVHC-BXOWXZKISA-N |
| XLogP | 3.16 |
| TPSA | 168.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.79 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|