C9H10Cl2N2 — CID 158778136
7H-pyrido[2,3-d]azepine;dihydrochloride (PubChem CID 158778136) has the molecular formula C9H10Cl2N2 and a molecular weight of 217.10 g/mol. Its IUPAC name is 7H-pyrido[2,3-d]azepine;dihydrochloride.
| Compound Name | 7H-pyrido[2,3-d]azepine;dihydrochloride |
|---|---|
| PubChem CID | 158778136 |
| Molecular Formula | C9H10Cl2N2 |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | 7H-pyrido[2,3-d]azepine;dihydrochloride |
| SMILES | C1=Cc2cccnc2C=CN1.Cl.Cl |
| InChI | InChI=1S/C9H8N2.2ClH/c1-2-8-3-6-10-7-4-9(8)11-5-1;;/h1-7,10H;2*1H |
| InChIKey | JDVJKCFIFHKMLZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |