C10H11N3 — CID 143248604
7-methylpyrido[2,3-c]azepin-7-amine (PubChem CID 143248604) has the molecular formula C10H11N3 and a molecular weight of 173.22 g/mol. Its IUPAC name is 7-methylpyrido[2,3-c]azepin-7-amine.
| Compound Name | 7-methylpyrido[2,3-c]azepin-7-amine |
|---|---|
| PubChem CID | 143248604 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | 7-methylpyrido[2,3-c]azepin-7-amine |
| SMILES | CC1(N)C=Cc2cccnc2C=N1 |
| InChI | InChI=1S/C10H11N3/c1-10(11)5-4-8-3-2-6-12-9(8)7-13-10/h2-7H,11H2,1H3 |
| InChIKey | PGNMJUBANMPGBD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 51.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |