About 3-iodo-3-methylpyrido[3,2-c]diazepine
3-iodo-3-methylpyrido[3,2-c]diazepine (PubChem CID 143335420) has the molecular formula C9H8IN3
and a molecular weight of 285.09 g/mol. Its IUPAC name is 3-iodo-3-methylpyrido[3,2-c]diazepine.
Molecular Properties
| Compound Name | 3-iodo-3-methylpyrido[3,2-c]diazepine |
| PubChem CID | 143335420 |
| Molecular Formula | C9H8IN3 |
| Molecular Weight | 285.09 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 3-iodo-3-methylpyrido[3,2-c]diazepine |
| SMILES | CC1(I)C=Cc2ncccc2N=N1 |
| InChI | InChI=1S/C9H8IN3/c1-9(10)5-4-7-8(12-13-9)3-2-6-11-7/h2-6H,1H3 |
| InChIKey | JVLYGFOACOJGGH-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.09 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 3-iodo-3-methylpyrido[3,2-c]diazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-iodo-3-methylpyrido[3,2-c]diazepine?
The IUPAC name of 3-iodo-3-methylpyrido[3,2-c]diazepine (CID 143335420) is 3-iodo-3-methylpyrido[3,2-c]diazepine.
What is the SMILES notation for 3-iodo-3-methylpyrido[3,2-c]diazepine?
The canonical SMILES for 3-iodo-3-methylpyrido[3,2-c]diazepine is CC1(I)C=Cc2ncccc2N=N1.
What is the InChIKey of 3-iodo-3-methylpyrido[3,2-c]diazepine?
The InChIKey is JVLYGFOACOJGGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8IN3/c1-9(10)5-4-7-8(12-13-9)3-2-6-11-7/h2-6H,1H3.
What are the key properties of 3-iodo-3-methylpyrido[3,2-c]diazepine?
3-iodo-3-methylpyrido[3,2-c]diazepine has a molecular weight of 285.09 g/mol, XLogP of 3.34, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-iodo-3-methylpyrido[3,2-c]diazepine is sourced from PubChem (CID 143335420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).