C26H33N3O5S — CID 158778188
N-(2-acetamidoethyl)-4-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-oxopropyl]sulfonyl-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 158778188) has the molecular formula C26H33N3O5S and a molecular weight of 499.63 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-4-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-oxopropyl]sulfonyl-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | N-(2-acetamidoethyl)-4-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-oxopropyl]sulfonyl-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 158778188 |
| Molecular Formula | C26H33N3O5S |
| Molecular Weight | 499.63 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | N-(2-acetamidoethyl)-4-[3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-oxopropyl]sulfonyl-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CC(=O)NCCN(C)C(=O)c1cc(S(=O)(=O)CC(=O)Cc2c3c(cc4c2CCC4)CCC3)cn1C |
| InChI | InChI=1S/C26H33N3O5S/c1-17(30)27-10-11-28(2)26(32)25-14-21(15-29(25)3)35(33,34)16-20(31)13-24-22-8-4-6-18(22)12-19-7-5-9-23(19)24/h12,14-15H,4-11,13,16H2,1-3H3,(H,27,30) |
| InChIKey | OMENDICDLMSZHF-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 105.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |