C24H56O7Si5 — CID 158798622
(3R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one (PubChem CID 158798622) has the molecular formula C24H56O7Si5 and a molecular weight of 597.14 g/mol. Its IUPAC name is (3R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one.
| Compound Name | (3R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one |
|---|---|
| PubChem CID | 158798622 |
| Molecular Formula | C24H56O7Si5 |
| Molecular Weight | 597.14 g/mol |
| Exact Mass | 596.29 |
| IUPAC Name | (3R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-3,4,5-tris(trimethylsilyloxy)-6-(trimethylsilyloxymethyl)oxan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@]1(CO[Si](C)(C)C)OC(=O)[C@H](O[Si](C)(C)C)[C@@H](O[Si](C)(C)C)[C@H]1O[Si](C)(C)C |
| InChI | InChI=1S/C24H56O7Si5/c1-23(2,3)36(16,17)31-24(18-26-32(4,5)6)21(30-35(13,14)15)19(28-33(7,8)9)20(22(25)27-24)29-34(10,11)12/h19-21H,18H2,1-17H3/t19-,20-,21-,24-/m1/s1 |
| InChIKey | ITEMVIBHSTWPDS-GECPAALWSA-N |
| XLogP | 6.77 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.14 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|