C40H38O5 — CID 158834073
4-[9-(3,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,2-diol;ethane;4-propan-2-ylnaphthalen-1-ol (PubChem CID 158834073) has the molecular formula C40H38O5 and a molecular weight of 598.74 g/mol. Its IUPAC name is 4-[9-(3,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,2-diol;ethane;4-propan-2-ylnaphthalen-1-ol.
| Compound Name | 4-[9-(3,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,2-diol;ethane;4-propan-2-ylnaphthalen-1-ol |
|---|---|
| PubChem CID | 158834073 |
| Molecular Formula | C40H38O5 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.27 |
| IUPAC Name | 4-[9-(3,4-dihydroxyphenyl)fluoren-9-yl]benzene-1,2-diol;ethane;4-propan-2-ylnaphthalen-1-ol |
| SMILES | CC.CC(C)c1ccc(O)c2ccccc12.Oc1ccc(C2(c3ccc(O)c(O)c3)c3ccccc3-c3ccccc32)cc1O |
| InChI | InChI=1S/C25H18O4.C13H14O.C2H6/c26-21-11-9-15(13-23(21)28)25(16-10-12-22(27)24(29)14-16)19-7-3-1-5-17(19)18-6-2-4-8-20(18)25;1-9(2)10-7-8-13(14)12-6-4-3-5-11(10)12;1-2/h1-14,26-29H;3-9,14H,1-2H3;1-2H3 |
| InChIKey | IXKHSNIATNFUNX-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|