C11H14F3NO — CID 158835126
1-[4-(2,2,2-trifluoroethylamino)phenyl]propan-2-ol (PubChem CID 158835126) has the molecular formula C11H14F3NO and a molecular weight of 233.23 g/mol. Its IUPAC name is 1-[4-(2,2,2-trifluoroethylamino)phenyl]propan-2-ol.
| Compound Name | 1-[4-(2,2,2-trifluoroethylamino)phenyl]propan-2-ol |
|---|---|
| PubChem CID | 158835126 |
| Molecular Formula | C11H14F3NO |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.10 |
| IUPAC Name | 1-[4-(2,2,2-trifluoroethylamino)phenyl]propan-2-ol |
| SMILES | CC(O)Cc1ccc(NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO/c1-8(16)6-9-2-4-10(5-3-9)15-7-11(12,13)14/h2-5,8,15-16H,6-7H2,1H3 |
| InChIKey | IXNNZUJJOJGKOM-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |