About aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine
aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine (PubChem CID 158840189) has the molecular formula C28H23BrN2O2
and a molecular weight of 499.41 g/mol. Its IUPAC name is aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine.
Molecular Properties
| Compound Name | aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine |
| PubChem CID | 158840189 |
| Molecular Formula | C28H23BrN2O2 |
| Molecular Weight | 499.41 g/mol |
| Exact Mass | 498.09 |
| IUPAC Name | aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine |
| SMILES | Brc1ccc2cocc2c1.Nc1ccccc1.c1ccc(Nc2ccc3cocc3c2)cc1 |
| InChI | InChI=1S/C14H11NO.C8H5BrO.C6H7N/c1-2-4-13(5-3-1)15-14-7-6-11-9-16-10-12(11)8-14;9-8-2-1-6-4-10-5-7(6)3-8;7-6-4-2-1-3-5-6/h1-10,15H;1-5H;1-5H,7H2 |
| InChIKey | IYDJABXQXKAERI-UHFFFAOYSA-N |
| XLogP | 8.64 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.41 |
| LogP ≤ 5 | 8.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine?
The IUPAC name of aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine (CID 158840189) is aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine.
What is the SMILES notation for aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine?
The canonical SMILES for aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine is Brc1ccc2cocc2c1.Nc1ccccc1.c1ccc(Nc2ccc3cocc3c2)cc1.
What is the InChIKey of aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine?
The InChIKey is IYDJABXQXKAERI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11NO.C8H5BrO.C6H7N/c1-2-4-13(5-3-1)15-14-7-6-11-9-16-10-12(11)8-14;9-8-2-1-6-4-10-5-7(6)3-8;7-6-4-2-1-3-5-6/h1-10,15H;1-5H;1-5H,7H2.
What are the key properties of aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine?
aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine has a molecular weight of 499.41 g/mol, XLogP of 8.64, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aniline;5-bromo-2-benzofuran;N-phenyl-2-benzofuran-5-amine is sourced from PubChem (CID 158840189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).