C27H25F3O2S — CID 158892039
2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium (PubChem CID 158892039) has the molecular formula C27H25F3O2S and a molecular weight of 470.56 g/mol. Its IUPAC name is 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium.
| Compound Name | 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 158892039 |
| Molecular Formula | C27H25F3O2S |
| Molecular Weight | 470.56 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 2-(trifluoromethyl)bicyclo[2.2.1]heptane-2-carboxylate;triphenylsulfanium |
| SMILES | O=C([O-])C1(C(F)(F)F)CC2CCC1C2.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C9H11F3O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;10-9(11,12)8(7(13)14)4-5-1-2-6(8)3-5/h1-15H;5-6H,1-4H2,(H,13,14)/q+1;/p-1 |
| InChIKey | JEJAHXGBEMHYAH-UHFFFAOYSA-M |
| XLogP | 5.89 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|