C32H29F3O2S — CID 157115644
4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;triphenylsulfanium (PubChem CID 157115644) has the molecular formula C32H29F3O2S and a molecular weight of 534.64 g/mol. Its IUPAC name is 4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;triphenylsulfanium.
| Compound Name | 4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;triphenylsulfanium |
|---|---|
| PubChem CID | 157115644 |
| Molecular Formula | C32H29F3O2S |
| Molecular Weight | 534.64 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 4-(trifluoromethyl)tetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylate;triphenylsulfanium |
| SMILES | O=C([O-])C1(C(F)(F)F)CC2CC1C1C3C=CC(C3)C21.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C14H15F3O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-14(16,17)13(12(18)19)5-8-4-9(13)11-7-2-1-6(3-7)10(8)11/h1-15H;1-2,6-11H,3-5H2,(H,18,19)/q+1;/p-1 |
| InChIKey | AHJGZASEGXQCTL-UHFFFAOYSA-M |
| XLogP | 6.55 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.64 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|