C22H33BO2 — CID 158895926
2-[3-(1-adamantyl)-2-methylcyclopenta-1,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158895926) has the molecular formula C22H33BO2 and a molecular weight of 340.32 g/mol. Its IUPAC name is 2-[3-(1-adamantyl)-2-methylcyclopenta-1,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[3-(1-adamantyl)-2-methylcyclopenta-1,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158895926 |
| Molecular Formula | C22H33BO2 |
| Molecular Weight | 340.32 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 2-[3-(1-adamantyl)-2-methylcyclopenta-1,4-dien-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1=C(B2OC(C)(C)C(C)(C)O2)C=CC1C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H33BO2/c1-14-18(22-11-15-8-16(12-22)10-17(9-15)13-22)6-7-19(14)23-24-20(2,3)21(4,5)25-23/h6-7,15-18H,8-13H2,1-5H3 |
| InChIKey | IZWMXTDKSFALRA-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.32 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|