C15H13S3+ — CID 158902065
2,6-bis(5-methylthiophen-2-yl)thiopyrylium (PubChem CID 158902065) has the molecular formula C15H13S3+ and a molecular weight of 289.47 g/mol. Its IUPAC name is 2,6-bis(5-methylthiophen-2-yl)thiopyrylium.
| Compound Name | 2,6-bis(5-methylthiophen-2-yl)thiopyrylium |
|---|---|
| PubChem CID | 158902065 |
| Molecular Formula | C15H13S3+ |
| Molecular Weight | 289.47 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2,6-bis(5-methylthiophen-2-yl)thiopyrylium |
| SMILES | Cc1ccc(-c2cccc(-c3ccc(C)s3)[s+]2)s1 |
| InChI | InChI=1S/C15H13S3/c1-10-6-8-14(16-10)12-4-3-5-13(18-12)15-9-7-11(2)17-15/h3-9H,1-2H3/q+1 |
| InChIKey | PIBRXZMJGDJAKB-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.47 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|