C19H36N2O5S4 — CID 158907695
N-[2-(2-oxobutyldisulfanyl)ethyl]acetamide;N-[2-[2-(3-oxopentoxy)ethyldisulfanyl]ethyl]acetamide (PubChem CID 158907695) has the molecular formula C19H36N2O5S4 and a molecular weight of 500.77 g/mol. Its IUPAC name is N-[2-(2-oxobutyldisulfanyl)ethyl]acetamide;N-[2-[2-(3-oxopentoxy)ethyldisulfanyl]ethyl]acetamide.
| Compound Name | N-[2-(2-oxobutyldisulfanyl)ethyl]acetamide;N-[2-[2-(3-oxopentoxy)ethyldisulfanyl]ethyl]acetamide |
|---|---|
| PubChem CID | 158907695 |
| Molecular Formula | C19H36N2O5S4 |
| Molecular Weight | 500.77 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | N-[2-(2-oxobutyldisulfanyl)ethyl]acetamide;N-[2-[2-(3-oxopentoxy)ethyldisulfanyl]ethyl]acetamide |
| SMILES | CCC(=O)CCOCCSSCCNC(C)=O.CCC(=O)CSSCCNC(C)=O |
| InChI | InChI=1S/C11H21NO3S2.C8H15NO2S2/c1-3-11(14)4-6-15-7-9-17-16-8-5-12-10(2)13;1-3-8(11)6-13-12-5-4-9-7(2)10/h3-9H2,1-2H3,(H,12,13);3-6H2,1-2H3,(H,9,10) |
| InChIKey | JGGFNDOXDKHKJM-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.77 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|