C28H25BrF2N4O4S2 — CID 158908810
1-(2-bromoethyl)-3-(4-fluoro-2-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide;3-(4-fluoro-2-methylphenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide (PubChem CID 158908810) has the molecular formula C28H25BrF2N4O4S2 and a molecular weight of 663.57 g/mol. Its IUPAC name is 1-(2-bromoethyl)-3-(4-fluoro-2-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide;3-(4-fluoro-2-methylphenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide.
| Compound Name | 1-(2-bromoethyl)-3-(4-fluoro-2-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide;3-(4-fluoro-2-methylphenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide |
|---|---|
| PubChem CID | 158908810 |
| Molecular Formula | C28H25BrF2N4O4S2 |
| Molecular Weight | 663.57 g/mol |
| Exact Mass | 662.05 |
| IUPAC Name | 1-(2-bromoethyl)-3-(4-fluoro-2-methylphenyl)-2λ6,1,3-benzothiadiazole 2,2-dioxide;3-(4-fluoro-2-methylphenyl)-1H-2λ6,1,3-benzothiadiazole 2,2-dioxide |
| SMILES | Cc1cc(F)ccc1N1c2ccccc2N(CCBr)S1(=O)=O.Cc1cc(F)ccc1N1c2ccccc2NS1(=O)=O |
| InChI | InChI=1S/C15H14BrFN2O2S.C13H11FN2O2S/c1-11-10-12(17)6-7-13(11)19-15-5-3-2-4-14(15)18(9-8-16)22(19,20)21;1-9-8-10(14)6-7-12(9)16-13-5-3-2-4-11(13)15-19(16,17)18/h2-7,10H,8-9H2,1H3;2-8,15H,1H3 |
| InChIKey | JGJPDMSBWBYPML-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.57 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|