C39H46F2O4S — CID 158915942
3-(adamantane-1-carbonyloxy)-2,2-difluoro-4-methylpentanoate;(4-tert-butylphenyl)-diphenylsulfanium (PubChem CID 158915942) has the molecular formula C39H46F2O4S and a molecular weight of 648.86 g/mol. Its IUPAC name is 3-(adamantane-1-carbonyloxy)-2,2-difluoro-4-methylpentanoate;(4-tert-butylphenyl)-diphenylsulfanium.
| Compound Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-4-methylpentanoate;(4-tert-butylphenyl)-diphenylsulfanium |
|---|---|
| PubChem CID | 158915942 |
| Molecular Formula | C39H46F2O4S |
| Molecular Weight | 648.86 g/mol |
| Exact Mass | 648.31 |
| IUPAC Name | 3-(adamantane-1-carbonyloxy)-2,2-difluoro-4-methylpentanoate;(4-tert-butylphenyl)-diphenylsulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccccc2)c2ccccc2)cc1.CC(C)C(OC(=O)C12CC3CC(CC(C3)C1)C2)C(F)(F)C(=O)[O-] |
| InChI | InChI=1S/C22H23S.C17H24F2O4/c1-22(2,3)18-14-16-21(17-15-18)23(19-10-6-4-7-11-19)20-12-8-5-9-13-20;1-9(2)13(17(18,19)14(20)21)23-15(22)16-6-10-3-11(7-16)5-12(4-10)8-16/h4-17H,1-3H3;9-13H,3-8H2,1-2H3,(H,20,21)/q+1;/p-1 |
| InChIKey | JHFPFOOIKJUXGZ-UHFFFAOYSA-M |
| XLogP | 8.24 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.86 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|