C21H19BrF8N2 — CID 158916569
4-bromo-2,3,5,6-tetrafluoroaniline;4-(3-ethylhept-1-ynyl)-2,3,5,6-tetrafluoroaniline (PubChem CID 158916569) has the molecular formula C21H19BrF8N2 and a molecular weight of 531.29 g/mol. Its IUPAC name is 4-bromo-2,3,5,6-tetrafluoroaniline;4-(3-ethylhept-1-ynyl)-2,3,5,6-tetrafluoroaniline.
| Compound Name | 4-bromo-2,3,5,6-tetrafluoroaniline;4-(3-ethylhept-1-ynyl)-2,3,5,6-tetrafluoroaniline |
|---|---|
| PubChem CID | 158916569 |
| Molecular Formula | C21H19BrF8N2 |
| Molecular Weight | 531.29 g/mol |
| Exact Mass | 530.06 |
| IUPAC Name | 4-bromo-2,3,5,6-tetrafluoroaniline;4-(3-ethylhept-1-ynyl)-2,3,5,6-tetrafluoroaniline |
| SMILES | CCCCC(C#Cc1c(F)c(F)c(N)c(F)c1F)CC.Nc1c(F)c(F)c(Br)c(F)c1F |
| InChI | InChI=1S/C15H17F4N.C6H2BrF4N/c1-3-5-6-9(4-2)7-8-10-11(16)13(18)15(20)14(19)12(10)17;7-1-2(8)4(10)6(12)5(11)3(1)9/h9H,3-6,20H2,1-2H3;12H2 |
| InChIKey | JHHMBTBZHNKGPS-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.29 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|