About 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane
3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane (PubChem CID 158924123) has the molecular formula C11H29N3O4
and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane.
Molecular Properties
| Compound Name | 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane |
| PubChem CID | 158924123 |
| Molecular Formula | C11H29N3O4 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane |
| SMILES | C.C.C.C=CCN=[N+]=[N-].CC(O)COCCOO |
| InChI | InChI=1S/C5H12O4.C3H5N3.3CH4/c1-5(6)4-8-2-3-9-7;1-2-3-5-6-4;;;/h5-7H,2-4H2,1H3;2H,1,3H2;3*1H4 |
| InChIKey | JIFDISSGPBCJOI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 107.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane?
The IUPAC name of 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane (CID 158924123) is 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane.
What is the SMILES notation for 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane?
The canonical SMILES for 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane is C.C.C.C=CCN=[N+]=[N-].CC(O)COCCOO.
What is the InChIKey of 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane?
The InChIKey is JIFDISSGPBCJOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O4.C3H5N3.3CH4/c1-5(6)4-8-2-3-9-7;1-2-3-5-6-4;;;/h5-7H,2-4H2,1H3;2H,1,3H2;3*1H4.
What are the key properties of 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane?
3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane has a molecular weight of 267.37 g/mol, XLogP of 3.26, 7 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-azidoprop-1-ene;1-(2-hydroperoxyethoxy)propan-2-ol;methane is sourced from PubChem (CID 158924123), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).