C23H20N2O5 — CID 158943825
2-[(1S)-1-methyl-2,4-dioxocyclohexyl]-5-(3-oxo-3-pyridin-4-ylpropyl)isoindole-1,3-dione (PubChem CID 158943825) has the molecular formula C23H20N2O5 and a molecular weight of 404.42 g/mol. Its IUPAC name is 2-[(1S)-1-methyl-2,4-dioxocyclohexyl]-5-(3-oxo-3-pyridin-4-ylpropyl)isoindole-1,3-dione.
| Compound Name | 2-[(1S)-1-methyl-2,4-dioxocyclohexyl]-5-(3-oxo-3-pyridin-4-ylpropyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 158943825 |
| Molecular Formula | C23H20N2O5 |
| Molecular Weight | 404.42 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-[(1S)-1-methyl-2,4-dioxocyclohexyl]-5-(3-oxo-3-pyridin-4-ylpropyl)isoindole-1,3-dione |
| SMILES | C[C@]1(N2C(=O)c3ccc(CCC(=O)c4ccncc4)cc3C2=O)CCC(=O)CC1=O |
| InChI | InChI=1S/C23H20N2O5/c1-23(9-6-16(26)13-20(23)28)25-21(29)17-4-2-14(12-18(17)22(25)30)3-5-19(27)15-7-10-24-11-8-15/h2,4,7-8,10-12H,3,5-6,9,13H2,1H3/t23-/m0/s1 |
| InChIKey | JKORVJFUBBOUNG-QHCPKHFHSA-N |
| XLogP | 2.57 |
| TPSA | 101.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|