C25H27NO5 — CID 158947282
ethyl 1-(3-hydroxybutan-2-yl)-4-oxo-6-(2-phenylmethoxyphenyl)pyridine-3-carboxylate (PubChem CID 158947282) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl 1-(3-hydroxybutan-2-yl)-4-oxo-6-(2-phenylmethoxyphenyl)pyridine-3-carboxylate.
| Compound Name | ethyl 1-(3-hydroxybutan-2-yl)-4-oxo-6-(2-phenylmethoxyphenyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 158947282 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | ethyl 1-(3-hydroxybutan-2-yl)-4-oxo-6-(2-phenylmethoxyphenyl)pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(C)C(C)O)c(-c2ccccc2OCc2ccccc2)cc1=O |
| InChI | InChI=1S/C25H27NO5/c1-4-30-25(29)21-15-26(17(2)18(3)27)22(14-23(21)28)20-12-8-9-13-24(20)31-16-19-10-6-5-7-11-19/h5-15,17-18,27H,4,16H2,1-3H3 |
| InChIKey | MJDNVJYQJAPVBN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |