C18H19NO5 — CID 57196601
[(2S,3R)-2-amino-3-hydroxybutanoyl] 2-phenylmethoxybenzoate (PubChem CID 57196601) has the molecular formula C18H19NO5 and a molecular weight of 329.35 g/mol. Its IUPAC name is [(2S,3R)-2-amino-3-hydroxybutanoyl] 2-phenylmethoxybenzoate.
| Compound Name | [(2S,3R)-2-amino-3-hydroxybutanoyl] 2-phenylmethoxybenzoate |
|---|---|
| PubChem CID | 57196601 |
| Molecular Formula | C18H19NO5 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | [(2S,3R)-2-amino-3-hydroxybutanoyl] 2-phenylmethoxybenzoate |
| SMILES | C[C@@H](O)[C@H](N)C(=O)OC(=O)c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H19NO5/c1-12(20)16(19)18(22)24-17(21)14-9-5-6-10-15(14)23-11-13-7-3-2-4-8-13/h2-10,12,16,20H,11,19H2,1H3/t12-,16+/m1/s1 |
| InChIKey | WSAPFKRIYBLSCX-WBMJQRKESA-N |
| XLogP | 1.66 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|