C46H64N12O14 — CID 158964803
bis(tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate);ethyl acetate (PubChem CID 158964803) has the molecular formula C46H64N12O14 and a molecular weight of 1009.09 g/mol. Its IUPAC name is bis(tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate);ethyl acetate.
| Compound Name | bis(tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate);ethyl acetate |
|---|---|
| PubChem CID | 158964803 |
| Molecular Formula | C46H64N12O14 |
| Molecular Weight | 1009.09 g/mol |
| Exact Mass | 1008.47 |
| IUPAC Name | bis(tert-butyl (2S)-2-[[2-(diethylamino)-5-nitropyrimidin-4-yl]amino]-3-(4-nitrophenyl)propanoate);ethyl acetate |
| SMILES | CCN(CC)c1ncc([N+](=O)[O-])c(N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)OC(C)(C)C)n1.CCN(CC)c1ncc([N+](=O)[O-])c(N[C@@H](Cc2ccc([N+](=O)[O-])cc2)C(=O)OC(C)(C)C)n1.CCOC(C)=O |
| InChI | InChI=1S/2C21H28N6O6.C4H8O2/c2*1-6-25(7-2)20-22-13-17(27(31)32)18(24-20)23-16(19(28)33-21(3,4)5)12-14-8-10-15(11-9-14)26(29)30;1-3-6-4(2)5/h2*8-11,13,16H,6-7,12H2,1-5H3,(H,22,23,24);3H2,1-2H3/t2*16-;/m00./s1 |
| InChIKey | JNBHQUOSSRXTFO-WUBQCMAVSA-N |
| XLogP | 7.58 |
| TPSA | 333.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1009.09 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|