C13H14CuF6O2 — CID 158976569
copper;cycloocta-1,5-diene;1,1,1,5,5,5-hexafluoropentane-2,4-dione (PubChem CID 158976569) has the molecular formula C13H14CuF6O2 and a molecular weight of 379.79 g/mol. Its IUPAC name is copper;cycloocta-1,5-diene;1,1,1,5,5,5-hexafluoropentane-2,4-dione.
| Compound Name | copper;cycloocta-1,5-diene;1,1,1,5,5,5-hexafluoropentane-2,4-dione |
|---|---|
| PubChem CID | 158976569 |
| Molecular Formula | C13H14CuF6O2 |
| Molecular Weight | 379.79 g/mol |
| Exact Mass | 379.02 |
| IUPAC Name | copper;cycloocta-1,5-diene;1,1,1,5,5,5-hexafluoropentane-2,4-dione |
| SMILES | C1=CCCC=CCC1.O=C(CC(=O)C(F)(F)F)C(F)(F)F.[Cu] |
| InChI | InChI=1S/C8H12.C5H2F6O2.Cu/c1-2-4-6-8-7-5-3-1;6-4(7,8)2(12)1-3(13)5(9,10)11;/h1-2,7-8H,3-6H2;1H2; |
| InChIKey | JOLURLQBADSSPV-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.79 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|