C44H42N8Zn — CID 158989402
5,10,15,20-tetrakis(1-methyl-2H-pyridin-4-yl)-21,23-dihydroporphyrin;zinc (PubChem CID 158989402) has the molecular formula C44H42N8Zn and a molecular weight of 748.27 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(1-methyl-2H-pyridin-4-yl)-21,23-dihydroporphyrin;zinc.
| Compound Name | 5,10,15,20-tetrakis(1-methyl-2H-pyridin-4-yl)-21,23-dihydroporphyrin;zinc |
|---|---|
| PubChem CID | 158989402 |
| Molecular Formula | C44H42N8Zn |
| Molecular Weight | 748.27 g/mol |
| Exact Mass | 746.28 |
| IUPAC Name | 5,10,15,20-tetrakis(1-methyl-2H-pyridin-4-yl)-21,23-dihydroporphyrin;zinc |
| SMILES | CN1C=CC(c2c3nc(c(C4=CCN(C)C=C4)c4ccc([nH]4)c(C4=CCN(C)C=C4)c4nc(c(C5=CCN(C)C=C5)c5ccc2[nH]5)C=C4)C=C3)=CC1.[Zn] |
| InChI | InChI=1S/C44H42N8.Zn/c1-49-21-13-29(14-22-49)41-33-5-7-35(45-33)42(30-15-23-50(2)24-16-30)37-9-11-39(47-37)44(32-19-27-52(4)28-20-32)40-12-10-38(48-40)43(36-8-6-34(41)46-36)31-17-25-51(3)26-18-31;/h5-21,23,25,27,45,48H,22,24,26,28H2,1-4H3;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | JPZAHXXJDMCNAG-DAJBKUBHSA-N |
| XLogP | 8.02 |
| TPSA | 70.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 748.27 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|