C44H22Cl8N4Zn — CID 175086452
5,10,15,20-tetrakis(2,5-dichlorophenyl)-21,23-dihydroporphyrin;zinc (PubChem CID 175086452) has the molecular formula C44H22Cl8N4Zn and a molecular weight of 955.70 g/mol. Its IUPAC name is 5,10,15,20-tetrakis(2,5-dichlorophenyl)-21,23-dihydroporphyrin;zinc.
| Compound Name | 5,10,15,20-tetrakis(2,5-dichlorophenyl)-21,23-dihydroporphyrin;zinc |
|---|---|
| PubChem CID | 175086452 |
| Molecular Formula | C44H22Cl8N4Zn |
| Molecular Weight | 955.70 g/mol |
| Exact Mass | 949.86 |
| IUPAC Name | 5,10,15,20-tetrakis(2,5-dichlorophenyl)-21,23-dihydroporphyrin;zinc |
| SMILES | Clc1ccc(Cl)c(-c2c3nc(c(-c4cc(Cl)ccc4Cl)c4ccc([nH]4)c(-c4cc(Cl)ccc4Cl)c4nc(c(-c5cc(Cl)ccc5Cl)c5ccc2[nH]5)C=C4)C=C3)c1.[Zn] |
| InChI | InChI=1S/C44H22Cl8N4.Zn/c45-21-1-5-29(49)25(17-21)41-33-9-11-35(53-33)42(26-18-22(46)2-6-30(26)50)37-13-15-39(55-37)44(28-20-24(48)4-8-32(28)52)40-16-14-38(56-40)43(36-12-10-34(41)54-36)27-19-23(47)3-7-31(27)51;/h1-20,53,56H;/b41-33-,41-34-,42-35-,42-37-,43-36-,43-38-,44-39-,44-40-; |
| InChIKey | BKSOFJGUDHPXFV-DAJBKUBHSA-N |
| XLogP | 16.55 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 955.70 |
| LogP ≤ 5 | 16.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|