C28H38BBrO4 — CID 158995634
[1-(4-bromophenyl)cyclobutyl]methanol;[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]methanol (PubChem CID 158995634) has the molecular formula C28H38BBrO4 and a molecular weight of 529.32 g/mol. Its IUPAC name is [1-(4-bromophenyl)cyclobutyl]methanol;[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]methanol.
| Compound Name | [1-(4-bromophenyl)cyclobutyl]methanol;[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]methanol |
|---|---|
| PubChem CID | 158995634 |
| Molecular Formula | C28H38BBrO4 |
| Molecular Weight | 529.32 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | [1-(4-bromophenyl)cyclobutyl]methanol;[1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]cyclobutyl]methanol |
| SMILES | CC1(C)OB(c2ccc(C3(CO)CCC3)cc2)OC1(C)C.OCC1(c2ccc(Br)cc2)CCC1 |
| InChI | InChI=1S/C17H25BO3.C11H13BrO/c1-15(2)16(3,4)21-18(20-15)14-8-6-13(7-9-14)17(12-19)10-5-11-17;12-10-4-2-9(3-5-10)11(8-13)6-1-7-11/h6-9,19H,5,10-12H2,1-4H3;2-5,13H,1,6-8H2 |
| InChIKey | JQRZGJFLJCNCSR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.32 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|