C19H29BO5 — CID 123270706
1-ethoxy-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetan-3-yl]ethanol (PubChem CID 123270706) has the molecular formula C19H29BO5 and a molecular weight of 348.25 g/mol. Its IUPAC name is 1-ethoxy-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetan-3-yl]ethanol.
| Compound Name | 1-ethoxy-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetan-3-yl]ethanol |
|---|---|
| PubChem CID | 123270706 |
| Molecular Formula | C19H29BO5 |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.21 |
| IUPAC Name | 1-ethoxy-2-[3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]oxetan-3-yl]ethanol |
| SMILES | CCOC(O)CC1(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)COC1 |
| InChI | InChI=1S/C19H29BO5/c1-6-23-16(21)11-19(12-22-13-19)14-7-9-15(10-8-14)20-24-17(2,3)18(4,5)25-20/h7-10,16,21H,6,11-13H2,1-5H3 |
| InChIKey | VCVJJYARQBISKP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|