C32H43ClN2O7 — CID 159000378
tert-butyl N-[(3R,6R)-7-[[5-chloro-2-(6-hydroxy-2-oxohexoxy)phenyl]methylamino]-6-methyl-4,7-dioxo-1-phenylheptan-3-yl]carbamate (PubChem CID 159000378) has the molecular formula C32H43ClN2O7 and a molecular weight of 603.16 g/mol. Its IUPAC name is tert-butyl N-[(3R,6R)-7-[[5-chloro-2-(6-hydroxy-2-oxohexoxy)phenyl]methylamino]-6-methyl-4,7-dioxo-1-phenylheptan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,6R)-7-[[5-chloro-2-(6-hydroxy-2-oxohexoxy)phenyl]methylamino]-6-methyl-4,7-dioxo-1-phenylheptan-3-yl]carbamate |
|---|---|
| PubChem CID | 159000378 |
| Molecular Formula | C32H43ClN2O7 |
| Molecular Weight | 603.16 g/mol |
| Exact Mass | 602.28 |
| IUPAC Name | tert-butyl N-[(3R,6R)-7-[[5-chloro-2-(6-hydroxy-2-oxohexoxy)phenyl]methylamino]-6-methyl-4,7-dioxo-1-phenylheptan-3-yl]carbamate |
| SMILES | C[C@H](CC(=O)[C@@H](CCc1ccccc1)NC(=O)OC(C)(C)C)C(=O)NCc1cc(Cl)ccc1OCC(=O)CCCCO |
| InChI | InChI=1S/C32H43ClN2O7/c1-22(18-28(38)27(35-31(40)42-32(2,3)4)15-13-23-10-6-5-7-11-23)30(39)34-20-24-19-25(33)14-16-29(24)41-21-26(37)12-8-9-17-36/h5-7,10-11,14,16,19,22,27,36H,8-9,12-13,15,17-18,20-21H2,1-4H3,(H,34,39)(H,35,40)/t22-,27-/m1/s1 |
| InChIKey | LNLGUSCDRRBKCJ-AJTFRIOCSA-N |
| XLogP | 5.19 |
| TPSA | 131.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.16 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|