C26H46O8 — CID 159016890
dec-9-enoic acid;[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate (PubChem CID 159016890) has the molecular formula C26H46O8 and a molecular weight of 486.65 g/mol. Its IUPAC name is dec-9-enoic acid;[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate.
| Compound Name | dec-9-enoic acid;[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate |
|---|---|
| PubChem CID | 159016890 |
| Molecular Formula | C26H46O8 |
| Molecular Weight | 486.65 g/mol |
| Exact Mass | 486.32 |
| IUPAC Name | dec-9-enoic acid;[2-(3,4-dihydroxyoxolan-2-yl)-2-hydroxyethyl] dec-9-enoate |
| SMILES | C=CCCCCCCCC(=O)O.C=CCCCCCCCC(=O)OCC(O)C1OCC(O)C1O |
| InChI | InChI=1S/C16H28O6.C10H18O2/c1-2-3-4-5-6-7-8-9-14(19)21-11-13(18)16-15(20)12(17)10-22-16;1-2-3-4-5-6-7-8-9-10(11)12/h2,12-13,15-18,20H,1,3-11H2;2H,1,3-9H2,(H,11,12) |
| InChIKey | JTEXPIIOCATFHP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 133.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.65 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|