C20H28F2O15S2 — CID 159021875
[(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate;[(2R,3S,4S)-4-fluoro-5-hydroxy-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate (PubChem CID 159021875) has the molecular formula C20H28F2O15S2 and a molecular weight of 610.56 g/mol. Its IUPAC name is [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate;[(2R,3S,4S)-4-fluoro-5-hydroxy-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate.
| Compound Name | [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate;[(2R,3S,4S)-4-fluoro-5-hydroxy-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 159021875 |
| Molecular Formula | C20H28F2O15S2 |
| Molecular Weight | 610.56 g/mol |
| Exact Mass | 610.08 |
| IUPAC Name | [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate;[(2R,3S,4S)-4-fluoro-5-hydroxy-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate |
| SMILES | CC(=O)OC1S[C@H](COC(=O)CO)[C@@H](OC(=O)CO)[C@@H]1F.O=C(CO)OC[C@H]1SC(O)[C@@H](F)[C@@H]1OC(=O)CO |
| InChI | InChI=1S/C11H15FO8S.C9H13FO7S/c1-5(15)19-11-9(12)10(20-8(17)3-14)6(21-11)4-18-7(16)2-13;10-7-8(17-6(14)2-12)4(18-9(7)15)3-16-5(13)1-11/h6,9-11,13-14H,2-4H2,1H3;4,7-9,11-12,15H,1-3H2/t6-,9+,10-,11?;4-,7+,8-,9?/m11/s1 |
| InChIKey | JTUMRKLVLSQGCD-IWKUAQKMSA-N |
| XLogP | -3.03 |
| TPSA | 232.65 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.56 |
| LogP ≤ 5 | -3.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|