C36H32BrN5O6 — CID 159026503
5-[(1R)-2-azido-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one (PubChem CID 159026503) has the molecular formula C36H32BrN5O6 and a molecular weight of 710.59 g/mol. Its IUPAC name is 5-[(1R)-2-azido-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one.
| Compound Name | 5-[(1R)-2-azido-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
|---|---|
| PubChem CID | 159026503 |
| Molecular Formula | C36H32BrN5O6 |
| Molecular Weight | 710.59 g/mol |
| Exact Mass | 709.15 |
| IUPAC Name | 5-[(1R)-2-azido-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one;5-[(1R)-2-bromo-1-hydroxyethyl]-8-phenylmethoxy-1H-quinolin-2-one |
| SMILES | O=c1ccc2c([C@@H](O)CBr)ccc(OCc3ccccc3)c2[nH]1.[N-]=[N+]=NC[C@H](O)c1ccc(OCc2ccccc2)c2[nH]c(=O)ccc12 |
| InChI | InChI=1S/C18H16BrNO3.C18H16N4O3/c19-10-15(21)13-6-8-16(18-14(13)7-9-17(22)20-18)23-11-12-4-2-1-3-5-12;19-22-20-10-15(23)13-6-8-16(18-14(13)7-9-17(24)21-18)25-11-12-4-2-1-3-5-12/h1-9,15,21H,10-11H2,(H,20,22);1-9,15,23H,10-11H2,(H,21,24)/t2*15-/m00/s1 |
| InChIKey | JUINMZCPXGYVKD-HJIBXMCBSA-N |
| XLogP | 6.99 |
| TPSA | 173.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 710.59 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|