C10H20O7 — CID 159030949
2-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyethanol;prop-2-enoic acid (PubChem CID 159030949) has the molecular formula C10H20O7 and a molecular weight of 252.26 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyethanol;prop-2-enoic acid.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyethanol;prop-2-enoic acid |
|---|---|
| PubChem CID | 159030949 |
| Molecular Formula | C10H20O7 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]-2-methoxyethanol;prop-2-enoic acid |
| SMILES | C=CC(=O)O.COC(CO)OCCOCCO |
| InChI | InChI=1S/C7H16O5.C3H4O2/c1-10-7(6-9)12-5-4-11-3-2-8;1-2-3(4)5/h7-9H,2-6H2,1H3;2H,1H2,(H,4,5) |
| InChIKey | JUWKVMOTDOVUDC-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 105.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|